lagdo / tontine

app/Console/Commands/ConvertPoolProperties.php

Indentation +1 added lines, -1 removed lines

@@ -27,7 +27,7 @@
     /**
      * Execute the console command.
      *
-      * @return int
+     * @return int
      */
     public function handle()
     {

Spacing +1 added lines, -1 removed lines

@@ -29,7 +29,7 @@
     public function handle()
     {
         $pools = Pool::get();
-        foreach($pools as $pool)
+        foreach ($pools as $pool)
         {
             $currProperties = $pool->properties;
             $nextProperties = ['deposit' => [], 'remit' => []];

src/Service/Meeting/Saving/ProfitService.php

Spacing +17 added lines, -20 removed lines

@@ -33,12 +33,12 @@ 
      *
      * @return Builder|Relation
      */
-    private function getFundSessionsQuery(Session $currentSession, int $fundId): Builder|Relation
+    private function getFundSessionsQuery(Session $currentSession, int $fundId): Builder | Relation
     {
         $lastSessionDate = $currentSession->start_at->format('Y-m-d');
         // The closing sessions ids
         $closingSessionIds = array_keys($this->savingService->getFundClosings($fundId));
-        if(count($closingSessionIds) === 0)
+        if (count($closingSessionIds) === 0)
         {
             // No closing session yet
             return $this->tenantService->tontine()->sessions()
@@ -51,7 +51,7 @@ 
             ->whereDate('sessions.start_at', '<', $lastSessionDate)
             ->orderByDesc('sessions.start_at')
             ->get();
-        if($closingSessions->count() === 0)
+        if ($closingSessions->count() === 0)
         {
             // All the closing sessions are after the current session.
             return $this->tenantService->tontine()->sessions()
@@ -119,31 +119,31 @@ 
         int $profitAmount): Collection
     {
         // Set savings durations and distributions
-        foreach($savings as $saving)
+        foreach ($savings as $saving)
         {
             $saving->duration = $this->getSavingDuration($sessions, $saving);
             $saving->distribution = $saving->amount * $saving->duration;
             $saving->profit = 0;
         }
         // Reduce the distributions
-        $distributionGcd = (int)$savings->reduce(function($gcd, $saving) {
-            if($gcd === 0)
+        $distributionGcd = (int) $savings->reduce(function($gcd, $saving) {
+            if ($gcd === 0)
             {
                 return $saving->distribution;
             }
-            if($saving->duration === 0)
+            if ($saving->duration === 0)
             {
                 return $gcd;
             }
             return gmp_gcd($gcd, $saving->distribution);
         }, $savings->first()->distribution);
-        if($distributionGcd > 0)
+        if ($distributionGcd > 0)
         {
-            $sum = (int)($savings->sum('distribution') / $distributionGcd);
-            foreach($savings as $saving)
+            $sum = (int) ($savings->sum('distribution') / $distributionGcd);
+            foreach ($savings as $saving)
             {
                 $saving->distribution /= $distributionGcd;
-                $saving->profit = (int)($profitAmount * $saving->distribution / $sum);
+                $saving->profit = (int) ($profitAmount * $saving->distribution / $sum);
             }
         }
 
@@ -171,9 +171,8 @@ 
             ->orderBy('sessions.start_at', 'asc')
             ->with(['session', 'member']);
         $savings = $fundId > 0 ?
-            $query->where('savings.fund_id', $fundId)->get() :
-            $query->whereNull('savings.fund_id')->get();
-        if($savings->count() === 0)
+            $query->where('savings.fund_id', $fundId)->get() : $query->whereNull('savings.fund_id')->get();
+        if ($savings->count() === 0)
         {
             return $savings;
         }
@@ -193,13 +192,13 @@ 
         // The part value makes sense only iwhen there is more than 2 savings
         // with distribution greater than 0.
         $savings = $savings->filter(fn($saving) => $saving->distribution > 0);
-        if($savings->count() < 2)
+        if ($savings->count() < 2)
         {
             return 0;
         }
 
         $saving = $savings->first();
-        return (int)($saving->amount * $saving->duration / $saving->distribution);
+        return (int) ($saving->amount * $saving->duration / $saving->distribution);
     }
 
     /**
@@ -226,8 +225,7 @@ 
             ->select(DB::raw("sum(amount) as total"))
             ->whereIn('session_id', $sessionIds);
         $saving = $fundId > 0 ?
-            $query->where('savings.fund_id', $fundId)->first() :
-            $query->whereNull('savings.fund_id')->first();
+            $query->where('savings.fund_id', $fundId)->first() : $query->whereNull('savings.fund_id')->first();
         return $saving->total ?? 0;
     }
 
@@ -248,8 +246,7 @@ 
             ->where('debts.type', Debt::TYPE_INTEREST)
             ->whereIn('refunds.session_id', $sessionIds);
         $refund = $fundId > 0 ?
-            $query->where('loans.fund_id', $fundId)->first() :
-            $query->whereNull('loans.fund_id')->first();
+            $query->where('loans.fund_id', $fundId)->first() : $query->whereNull('loans.fund_id')->first();
         return $refund->total ?? 0;
     }
 

src/Service/Meeting/Pool/AuctionService.php

Spacing +3 added lines, -3 removed lines

@@ -29,7 +29,7 @@ 
      *
      * @return Builder|Relation
      */
-    private function getQuery(Session $session, ?bool $onlyPaid = null): Builder|Relation
+    private function getQuery(Session $session, ?bool $onlyPaid = null): Builder | Relation
     {
         $sessionId = $session->id;
         $prevSessions = $this->sessionService->getRoundSessionIds($session, withCurr: false);
@@ -44,7 +44,7 @@ 
                         $query->where('session_id', $sessionId);
                     });
                 });
-                if($prevSessions->count() === 0)
+                if ($prevSessions->count() === 0)
                 {
                     return;
                 }
@@ -113,7 +113,7 @@ 
     public function toggleAuctionPayment(Session $session, int $auctionId)
     {
         $auction = $this->getQuery($session)->find($auctionId);
-        if(($auction))
+        if (($auction))
         {
             $auction->update(['paid' => !$auction->paid]);
         }

src/Service/Meeting/Pool/PoolService.php

Spacing +1 added lines, -1 removed lines

@@ -44,7 +44,7 @@
      *
      * @return Builder|Relation
      */
-    private function getQuery(Session $session): Builder|Relation
+    private function getQuery(Session $session): Builder | Relation
     {
         return Pool::ofSession($session)
             ->whereHas('subscriptions', function(Builder $query) use($session) {

src/Service/Meeting/Credit/RefundService.php

Spacing +12 added lines, -12 removed lines

@@ -36,7 +36,7 @@ 
      *
      * @return Builder|Relation
      */
-    private function getQuery(Session $session, ?bool $onlyPaid = null): Builder|Relation
+    private function getQuery(Session $session, ?bool $onlyPaid = null): Builder | Relation
     {
         $sessionId = $session->id;
         $prevSessions = $this->sessionService->getTontineSessionIds($session, withCurr: false);
@@ -54,7 +54,7 @@ 
                         $query->where('session_id', $sessionId);
                     });
                 });
-                if($prevSessions->count() === 0)
+                if ($prevSessions->count() === 0)
                 {
                     return;
                 }
@@ -145,11 +145,11 @@ 
     public function createRefund(Session $session, int $debtId): void
     {
         $debt = $this->getDebt($session, $debtId);
-        if(!$debt || $debt->refund)
+        if (!$debt || $debt->refund)
         {
             throw new MessageException(trans('tontine.loan.errors.not_found'));
         }
-        if(!$this->debtCalculator->debtIsEditable($session, $debt))
+        if (!$this->debtCalculator->debtIsEditable($session, $debt))
         {
             throw new MessageException(trans('meeting.refund.errors.cannot_refund'));
         }
@@ -160,7 +160,7 @@ 
         DB::transaction(function() use($session, $debt, $refund) {
             $refund->save();
             // For simple or compound interest, also save the final amount.
-            if($debt->is_interest && !$debt->loan->fixed_interest)
+            if ($debt->is_interest && !$debt->loan->fixed_interest)
             {
                 $debt->amount = $this->debtCalculator->getDebtAmount($session, $debt);
                 $debt->save();
@@ -180,15 +180,15 @@ 
     {
         $refund = Refund::with('debt')->where('session_id', $session->id)
             ->where('debt_id', $debtId)->first();
-        if(!$refund)
+        if (!$refund)
         {
             throw new MessageException(trans('meeting.refund.errors.not_found'));
         }
-        if((!$refund->editable))
+        if ((!$refund->editable))
         {
             throw new MessageException(trans('meeting.refund.errors.cannot_delete'));
         }
-        if(!$this->debtCalculator->debtIsEditable($session, $refund->debt))
+        if (!$this->debtCalculator->debtIsEditable($session, $refund->debt))
         {
             throw new MessageException(trans('meeting.refund.errors.cannot_refund'));
         }
@@ -261,12 +261,12 @@ 
     public function createPartialRefund(Session $session, int $debtId, int $amount): void
     {
         $debt = $this->getDebt($session, $debtId);
-        if(!$debt || $debt->refund)
+        if (!$debt || $debt->refund)
         {
             throw new MessageException(trans('meeting.refund.errors.not_found'));
         }
         // A partial refund must not totally refund a debt
-        if($amount >= $debt->due_amount)
+        if ($amount >= $debt->due_amount)
         {
             throw new MessageException(trans('meeting.refund.errors.pr_amount'));
         }
@@ -290,11 +290,11 @@ 
     {
         $refund = PartialRefund::where('session_id', $session->id)
             ->with(['debt.refund'])->find($refundId);
-        if(!$refund)
+        if (!$refund)
         {
             throw new MessageException(trans('meeting.refund.errors.not_found'));
         }
-        if($refund->debt->refund !== null || !$refund->editable)
+        if ($refund->debt->refund !== null || !$refund->editable)
         {
             throw new MessageException(trans('meeting.refund.errors.cannot_delete'));
         }

src/Service/Meeting/Charge/SettlementTargetService.php

Spacing +1 added lines, -1 removed lines

@@ -57,7 +57,7 @@
      *
      * @return Builder|Relation
      */
-    private function getMembersQuery(string $search = ''): Builder|Relation
+    private function getMembersQuery(string $search = ''): Builder | Relation
     {
         return $this->tenantService->tontine()->members()->active()
             ->when($search !== '', function($query) use($search) {

src/Service/Meeting/Charge/BillService.php

Spacing +3 added lines, -6 removed lines

@@ -34,7 +34,7 @@ 
      * @return Builder
      */
     private function getBillsQuery(Charge $charge, Session $session,
-        string $relation, string $search, ?bool $onlyPaid): Builder|Relation
+        string $relation, string $search, ?bool $onlyPaid): Builder | Relation
     {
         $relationFilter = function(Builder $query) use($charge, $session, $relation) {
             $query->where('charge_id', $charge->id)
@@ -90,9 +90,7 @@ 
     private function getBillRelation(Charge $charge): string
     {
         // The intermediate relation to reach the member model.
-        return $charge->is_variable ? 'libre_bill' :
-            ($charge->period_session ? 'session_bill' :
-            ($charge->period_round ? 'round_bill' : 'tontine_bill'));
+        return $charge->is_variable ? 'libre_bill' : ($charge->period_session ? 'session_bill' : ($charge->period_round ? 'round_bill' : 'tontine_bill'));
     }
 
     /**
@@ -108,8 +106,7 @@ 
         string $search = '', ?bool $onlyPaid = null, int $page = 0): Collection
     {
         $billRelation = $this->getBillRelation($charge);
-        $billRelations = !$charge->is_variable ? [$billRelation . '.member', 'settlement'] :
-            ['libre_bill.session', 'libre_bill.member', 'settlement'];
+        $billRelations = !$charge->is_variable ? [$billRelation . '.member', 'settlement'] : ['libre_bill.session', 'libre_bill.member', 'settlement'];
         $query = $this->getBillsQuery($charge, $session, $billRelation, $search, $onlyPaid);
 
         return $query->with($billRelations)

src/Service/Meeting/Charge/LibreFeeService.php

Spacing +10 added lines, -10 removed lines

@@ -176,7 +176,7 @@ 
      * @return Builder|Relation
      */
     private function getMembersQuery(Charge $charge, Session $session,
-        string $search = '', ?bool $filter): Builder|Relation
+        string $search = '', ?bool $filter): Builder | Relation
     {
         $filterFunction = function($query) use($charge, $session) {
             $query->where('charge_id', $charge->id)->where('session_id', $session->id);
@@ -221,7 +221,7 @@ 
                     $member->libre_bills->first()->bill : null;
             });
         // Check if there is a settlement target.
-        if(!($target = $this->targetService->getTarget($charge, $session)))
+        if (!($target = $this->targetService->getTarget($charge, $session)))
         {
             return $members;
         }
@@ -262,12 +262,12 @@ 
         int $memberId, bool $paid, float $amount = 0): void
     {
         $member = $this->tenantService->tontine()->members()->find($memberId);
-        if(!$member)
+        if (!$member)
         {
             throw new MessageException(trans('tontine.member.errors.not_found'));
         }
 
-        if($amount !== 0)
+        if ($amount !== 0)
         {
             $amount = $this->localeService->convertMoneyToInt($amount);
         }
@@ -284,7 +284,7 @@ 
             $libreBill->session()->associate($session);
             $libreBill->bill()->associate($bill);
             $libreBill->save();
-            if($paid)
+            if ($paid)
             {
                 $settlement = new Settlement();
                 $settlement->bill()->associate($bill);
@@ -303,7 +303,7 @@ 
      */
     public function getBill(Charge $charge, Session $session, int $memberId): ?LibreBill
     {
-        if(!($member = $this->tenantService->tontine()->members()->find($memberId)))
+        if (!($member = $this->tenantService->tontine()->members()->find($memberId)))
         {
             throw new MessageException(trans('tontine.member.errors.not_found'));
         }
@@ -325,7 +325,7 @@ 
      */
     public function updateBill(Charge $charge, Session $session, int $memberId, float $amount): void
     {
-        if(!($libreBill = $this->getBill($charge, $session, $memberId)))
+        if (!($libreBill = $this->getBill($charge, $session, $memberId)))
         {
             return; // throw new MessageException(trans('tontine.bill.errors.not_found'));
         }
@@ -344,7 +344,7 @@ 
      */
     public function deleteBill(Charge $charge, Session $session, int $memberId): void
     {
-        if(!($libreBill = $this->getBill($charge, $session, $memberId)))
+        if (!($libreBill = $this->getBill($charge, $session, $memberId)))
         {
             return; // throw new MessageException(trans('tontine.bill.errors.not_found'));
         }
@@ -352,10 +352,10 @@ 
         DB::transaction(function() use($libreBill, $session) {
             $bill = $libreBill->bill;
             $libreBill->delete();
-            if($bill !== null)
+            if ($bill !== null)
             {
                 // Delete the settlement only if it is on the same session
-                if($bill->settlement !== null && $bill->settlement->session_id === $session->id)
+                if ($bill->settlement !== null && $bill->settlement->session_id === $session->id)
                 {
                     $bill->settlement->delete();
                 }

app/Ajax/Web/Meeting/Credit/Loan.php

Spacing +13 added lines, -13 removed lines

@@ -73,7 +73,7 @@ 
      */
     public function addLoan()
     {
-        if($this->session->closed)
+        if ($this->session->closed)
         {
             $this->notify->warning(trans('meeting.warnings.session.closed'));
             return $this->response;
@@ -91,7 +91,7 @@ 
             'title' => trans('common.actions.cancel'),
             'class' => 'btn btn-tertiary',
             'click' => 'close',
-        ],[
+        ], [
             'title' => trans('common.actions.save'),
             'class' => 'btn btn-primary',
             'click' => $this->rq()->createLoan(pm()->form('loan-form')),
@@ -108,14 +108,14 @@ 
      */
     public function createLoan(array $formValues)
     {
-        if($this->session->closed)
+        if ($this->session->closed)
         {
             $this->notify->warning(trans('meeting.warnings.session.closed'));
             return $this->response;
         }
 
         $values = $this->validator->validateItem($formValues);
-        if(!($member = $this->memberService->getMember($values['member'])))
+        if (!($member = $this->memberService->getMember($values['member'])))
         {
             $this->notify->warning(trans('tontine.member.errors.not_found'));
             return $this->response;
@@ -133,19 +133,19 @@ 
      */
     public function editLoan(int $loanId)
     {
-        if($this->session->closed)
+        if ($this->session->closed)
         {
             $this->notify->warning(trans('meeting.warnings.session.closed'));
             return $this->response;
         }
         $loan = $this->loanService->getSessionLoan($this->session, $loanId);
-        if(!$loan)
+        if (!$loan)
         {
             $this->notify->warning(trans('meeting.loan.errors.not_found'));
             return $this->response;
         }
         // A refunded loan cannot be updated.
-        if($loan->refunds_count > 0)
+        if ($loan->refunds_count > 0)
         {
             $this->notify->warning(trans('meeting.loan.errors.update'));
             return $this->response;
@@ -162,7 +162,7 @@ 
             'title' => trans('common.actions.cancel'),
             'class' => 'btn btn-tertiary',
             'click' => 'close',
-        ],[
+        ], [
             'title' => trans('common.actions.save'),
             'class' => 'btn btn-primary',
             'click' => $this->rq()->updateLoan($loanId, pm()->form('loan-form')),
@@ -179,26 +179,26 @@ 
      */
     public function updateLoan(int $loanId, array $formValues)
     {
-        if($this->session->closed)
+        if ($this->session->closed)
         {
             $this->notify->warning(trans('meeting.warnings.session.closed'));
             return $this->response;
         }
         $loan = $this->loanService->getSessionLoan($this->session, $loanId);
-        if(!$loan)
+        if (!$loan)
         {
             $this->notify->warning(trans('meeting.loan.errors.not_found'));
             return $this->response;
         }
         // A refunded loan cannot be updated.
-        if($loan->refunds_count > 0)
+        if ($loan->refunds_count > 0)
         {
             $this->notify->warning(trans('meeting.loan.errors.update'));
             return $this->response;
         }
 
         $values = $this->validator->validateItem($formValues);
-        if(!($member = $this->memberService->getMember($values['member'])))
+        if (!($member = $this->memberService->getMember($values['member'])))
         {
             $this->notify->warning(trans('tontine.member.errors.not_found'));
             return $this->response;
@@ -216,7 +216,7 @@ 
      */
     public function deleteLoan(int $loanId)
     {
-        if($this->session->closed)
+        if ($this->session->closed)
         {
             $this->notify->warning(trans('meeting.warnings.session.closed'));
             return $this->response;